C25H24N4O5S — CID 1127079
[2-(benzotriazol-2-yl)-4-methylphenyl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 1127079) has the molecular formula C25H24N4O5S and a molecular weight of 492.56 g/mol. Its IUPAC name is [2-(benzotriazol-2-yl)-4-methylphenyl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-(benzotriazol-2-yl)-4-methylphenyl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 1127079 |
| Molecular Formula | C25H24N4O5S |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | [2-(benzotriazol-2-yl)-4-methylphenyl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | Cc1ccc(OC(=O)c2ccc(C)c(S(=O)(=O)N3CCOCC3)c2)c(-n2nc3ccccc3n2)c1 |
| InChI | InChI=1S/C25H24N4O5S/c1-17-7-10-23(22(15-17)29-26-20-5-3-4-6-21(20)27-29)34-25(30)19-9-8-18(2)24(16-19)35(31,32)28-11-13-33-14-12-28/h3-10,15-16H,11-14H2,1-2H3 |
| InChIKey | HQYOPJFKNDIYGM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 103.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|