C12H14NO5S- — CID 3668064
4-methyl-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 3668064) has the molecular formula C12H14NO5S- and a molecular weight of 284.31 g/mol. Its IUPAC name is 4-methyl-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | 4-methyl-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 3668064 |
| Molecular Formula | C12H14NO5S- |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 4-methyl-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | Cc1ccc(C(=O)[O-])cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C12H15NO5S/c1-9-2-3-10(12(14)15)8-11(9)19(16,17)13-4-6-18-7-5-13/h2-3,8H,4-7H2,1H3,(H,14,15)/p-1 |
| InChIKey | XWGOGAHEPWTCCH-UHFFFAOYSA-M |
| XLogP | -0.62 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |