C14H19NO6S — CID 166273277
4-(1,4,7-dioxazonan-7-ylsulfonyl)-3-methylbenzoic acid (PubChem CID 166273277) has the molecular formula C14H19NO6S and a molecular weight of 329.37 g/mol. Its IUPAC name is 4-(1,4,7-dioxazonan-7-ylsulfonyl)-3-methylbenzoic acid.
| Compound Name | 4-(1,4,7-dioxazonan-7-ylsulfonyl)-3-methylbenzoic acid |
|---|---|
| PubChem CID | 166273277 |
| Molecular Formula | C14H19NO6S |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 4-(1,4,7-dioxazonan-7-ylsulfonyl)-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1S(=O)(=O)N1CCOCCOCC1 |
| InChI | InChI=1S/C14H19NO6S/c1-11-10-12(14(16)17)2-3-13(11)22(18,19)15-4-6-20-8-9-21-7-5-15/h2-3,10H,4-9H2,1H3,(H,16,17) |
| InChIKey | NBWVVGZIYIQZTL-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |