C12H16LiNO4 — CID 159941307
lithium;3-methyl-4-morpholin-4-ylbenzoic acid;hydroxide (PubChem CID 159941307) has the molecular formula C12H16LiNO4 and a molecular weight of 245.20 g/mol. Its IUPAC name is lithium;3-methyl-4-morpholin-4-ylbenzoic acid;hydroxide.
| Compound Name | lithium;3-methyl-4-morpholin-4-ylbenzoic acid;hydroxide |
|---|---|
| PubChem CID | 159941307 |
| Molecular Formula | C12H16LiNO4 |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | lithium;3-methyl-4-morpholin-4-ylbenzoic acid;hydroxide |
| SMILES | Cc1cc(C(=O)O)ccc1N1CCOCC1.[Li+].[OH-] |
| InChI | InChI=1S/C12H15NO3.Li.H2O/c1-9-8-10(12(14)15)2-3-11(9)13-4-6-16-7-5-13;;/h2-3,8H,4-7H2,1H3,(H,14,15);;1H2/q;+1;/p-1 |
| InChIKey | OAXMFFXPPSBLQQ-UHFFFAOYSA-M |
| XLogP | -1.64 |
| TPSA | 79.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |