C21H21F3N2O2 — CID 138039163
(3-methyl-4-morpholin-4-ylphenyl)-(5,6,8-trifluoro-3,4-dihydro-2H-quinolin-1-yl)methanone (PubChem CID 138039163) has the molecular formula C21H21F3N2O2 and a molecular weight of 390.41 g/mol. Its IUPAC name is (3-methyl-4-morpholin-4-ylphenyl)-(5,6,8-trifluoro-3,4-dihydro-2H-quinolin-1-yl)methanone.
| Compound Name | (3-methyl-4-morpholin-4-ylphenyl)-(5,6,8-trifluoro-3,4-dihydro-2H-quinolin-1-yl)methanone |
|---|---|
| PubChem CID | 138039163 |
| Molecular Formula | C21H21F3N2O2 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | (3-methyl-4-morpholin-4-ylphenyl)-(5,6,8-trifluoro-3,4-dihydro-2H-quinolin-1-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCCc3c(F)c(F)cc(F)c32)ccc1N1CCOCC1 |
| InChI | InChI=1S/C21H21F3N2O2/c1-13-11-14(4-5-18(13)25-7-9-28-10-8-25)21(27)26-6-2-3-15-19(24)16(22)12-17(23)20(15)26/h4-5,11-12H,2-3,6-10H2,1H3 |
| InChIKey | GILHBEGJTDAPBP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|