C17H15F3N2OS — CID 154798835
[3-(methylsulfanylmethyl)-2-pyridinyl]-(5,6,8-trifluoro-3,4-dihydro-2H-quinolin-1-yl)methanone (PubChem CID 154798835) has the molecular formula C17H15F3N2OS and a molecular weight of 352.38 g/mol. Its IUPAC name is [3-(methylsulfanylmethyl)-2-pyridinyl]-(5,6,8-trifluoro-3,4-dihydro-2H-quinolin-1-yl)methanone.
| Compound Name | [3-(methylsulfanylmethyl)-2-pyridinyl]-(5,6,8-trifluoro-3,4-dihydro-2H-quinolin-1-yl)methanone |
|---|---|
| PubChem CID | 154798835 |
| Molecular Formula | C17H15F3N2OS |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | [3-(methylsulfanylmethyl)-2-pyridinyl]-(5,6,8-trifluoro-3,4-dihydro-2H-quinolin-1-yl)methanone |
| SMILES | CSCc1cccnc1C(=O)N1CCCc2c(F)c(F)cc(F)c21 |
| InChI | InChI=1S/C17H15F3N2OS/c1-24-9-10-4-2-6-21-15(10)17(23)22-7-3-5-11-14(20)12(18)8-13(19)16(11)22/h2,4,6,8H,3,5,7,9H2,1H3 |
| InChIKey | PPWXNVAQTBVDPU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|