4-(4-acetyl-1,4-diazepan-1-yl)-3-methylbenzoic acid

C15H20N2O3 — CID 62122513

IUPAC4-(4-acetyl-1,4-diazepan-1-yl)-3-methylbenzoic acid
SMILESCC(=O)N1CCCN(c2ccc(C(=O)O)cc2C)CC1
InChIInChI=1S/C15H20N2O3/c1-11-10-13(15(19)20)4-5-14(11)17-7-3-6-16(8-9-17)12(2)18/h4-5,10H,3,6-9H2,1-2H3,(H,19,20)
InChIKeyIBKAIDKPLALOEH-UHFFFAOYSA-N
MW276.34 g/mol
LogP1.75
Rot. Bonds2

About 4-(4-acetyl-1,4-diazepan-1-yl)-3-methylbenzoic acid

4-(4-acetyl-1,4-diazepan-1-yl)-3-methylbenzoic acid (PubChem CID 62122513) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 4-(4-acetyl-1,4-diazepan-1-yl)-3-methylbenzoic acid.

Molecular Properties

Compound Name4-(4-acetyl-1,4-diazepan-1-yl)-3-methylbenzoic acid
PubChem CID62122513
Molecular FormulaC15H20N2O3
Molecular Weight276.34 g/mol
Exact Mass276.15
IUPAC Name4-(4-acetyl-1,4-diazepan-1-yl)-3-methylbenzoic acid
SMILESCC(=O)N1CCCN(c2ccc(C(=O)O)cc2C)CC1
InChIInChI=1S/C15H20N2O3/c1-11-10-13(15(19)20)4-5-14(11)17-7-3-6-16(8-9-17)12(2)18/h4-5,10H,3,6-9H2,1-2H3,(H,19,20)
InChIKeyIBKAIDKPLALOEH-UHFFFAOYSA-N
XLogP1.75
TPSA60.85 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.34
LogP ≤ 51.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-(4-acetyl-1,4-diazepan-1-yl)-3-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4-acetyl-1,4-diazepan-1-yl)-3-methylbenzoic acid?
The IUPAC name of 4-(4-acetyl-1,4-diazepan-1-yl)-3-methylbenzoic acid (CID 62122513) is 4-(4-acetyl-1,4-diazepan-1-yl)-3-methylbenzoic acid.
What is the SMILES notation for 4-(4-acetyl-1,4-diazepan-1-yl)-3-methylbenzoic acid?
The canonical SMILES for 4-(4-acetyl-1,4-diazepan-1-yl)-3-methylbenzoic acid is CC(=O)N1CCCN(c2ccc(C(=O)O)cc2C)CC1.
What is the InChIKey of 4-(4-acetyl-1,4-diazepan-1-yl)-3-methylbenzoic acid?
The InChIKey is IBKAIDKPLALOEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O3/c1-11-10-13(15(19)20)4-5-14(11)17-7-3-6-16(8-9-17)12(2)18/h4-5,10H,3,6-9H2,1-2H3,(H,19,20).
What are the key properties of 4-(4-acetyl-1,4-diazepan-1-yl)-3-methylbenzoic acid?
4-(4-acetyl-1,4-diazepan-1-yl)-3-methylbenzoic acid has a molecular weight of 276.34 g/mol, XLogP of 1.75, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-acetyl-1,4-diazepan-1-yl)-3-methylbenzoic acid is sourced from PubChem (CID 62122513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).