C11H15NO3S — CID 110740045
3-(2,4-dimethylphenyl)sulfonyl-1,3-oxazolidine (PubChem CID 110740045) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)sulfonyl-1,3-oxazolidine.
| Compound Name | 3-(2,4-dimethylphenyl)sulfonyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 110740045 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 3-(2,4-dimethylphenyl)sulfonyl-1,3-oxazolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOC2)c(C)c1 |
| InChI | InChI=1S/C11H15NO3S/c1-9-3-4-11(10(2)7-9)16(13,14)12-5-6-15-8-12/h3-4,7H,5-6,8H2,1-2H3 |
| InChIKey | BKGFEJUZKLPHOU-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |