C15H24N2O4S2 — CID 110799630
1-(2,4-dimethylphenyl)sulfonyl-4-ethylsulfonyl-1,4-diazepane (PubChem CID 110799630) has the molecular formula C15H24N2O4S2 and a molecular weight of 360.50 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)sulfonyl-4-ethylsulfonyl-1,4-diazepane.
| Compound Name | 1-(2,4-dimethylphenyl)sulfonyl-4-ethylsulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 110799630 |
| Molecular Formula | C15H24N2O4S2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 1-(2,4-dimethylphenyl)sulfonyl-4-ethylsulfonyl-1,4-diazepane |
| SMILES | CCS(=O)(=O)N1CCCN(S(=O)(=O)c2ccc(C)cc2C)CC1 |
| InChI | InChI=1S/C15H24N2O4S2/c1-4-22(18,19)16-8-5-9-17(11-10-16)23(20,21)15-7-6-13(2)12-14(15)3/h6-7,12H,4-5,8-11H2,1-3H3 |
| InChIKey | VHRFZJMTHFIZBM-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |