C12H17NO3S2 — CID 110721585
4-(2,4-dimethylphenyl)sulfonyl-1,4-thiazinane 1-oxide (PubChem CID 110721585) has the molecular formula C12H17NO3S2 and a molecular weight of 287.41 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)sulfonyl-1,4-thiazinane 1-oxide.
| Compound Name | 4-(2,4-dimethylphenyl)sulfonyl-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 110721585 |
| Molecular Formula | C12H17NO3S2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 4-(2,4-dimethylphenyl)sulfonyl-1,4-thiazinane 1-oxide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCS(=O)CC2)c(C)c1 |
| InChI | InChI=1S/C12H17NO3S2/c1-10-3-4-12(11(2)9-10)18(15,16)13-5-7-17(14)8-6-13/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | IHOHBLKBYYPBCL-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |