C14H20N2O4S — CID 110818495
methyl 4-(2,4-dimethylphenyl)sulfonylpiperazine-1-carboxylate (PubChem CID 110818495) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is methyl 4-(2,4-dimethylphenyl)sulfonylpiperazine-1-carboxylate.
| Compound Name | methyl 4-(2,4-dimethylphenyl)sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 110818495 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | methyl 4-(2,4-dimethylphenyl)sulfonylpiperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(S(=O)(=O)c2ccc(C)cc2C)CC1 |
| InChI | InChI=1S/C14H20N2O4S/c1-11-4-5-13(12(2)10-11)21(18,19)16-8-6-15(7-9-16)14(17)20-3/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | HFNUYTLXGTYDHL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |