About (2-methoxyphenyl) 4-fluoro-3-morpholin-4-ylsulfonylbenzoate
(2-methoxyphenyl) 4-fluoro-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 8778499) has the molecular formula C18H18FNO6S
and a molecular weight of 395.41 g/mol. Its IUPAC name is (2-methoxyphenyl) 4-fluoro-3-morpholin-4-ylsulfonylbenzoate.
Molecular Properties
| Compound Name | (2-methoxyphenyl) 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
| PubChem CID | 8778499 |
| Molecular Formula | C18H18FNO6S |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | (2-methoxyphenyl) 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | COc1ccccc1OC(=O)c1ccc(F)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C18H18FNO6S/c1-24-15-4-2-3-5-16(15)26-18(21)13-6-7-14(19)17(12-13)27(22,23)20-8-10-25-11-9-20/h2-7,12H,8-11H2,1H3 |
| InChIKey | CWCHRHYAXNXYGS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-methoxyphenyl) 4-fluoro-3-morpholin-4-ylsulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxyphenyl) 4-fluoro-3-morpholin-4-ylsulfonylbenzoate?
The IUPAC name of (2-methoxyphenyl) 4-fluoro-3-morpholin-4-ylsulfonylbenzoate (CID 8778499) is (2-methoxyphenyl) 4-fluoro-3-morpholin-4-ylsulfonylbenzoate.
What is the SMILES notation for (2-methoxyphenyl) 4-fluoro-3-morpholin-4-ylsulfonylbenzoate?
The canonical SMILES for (2-methoxyphenyl) 4-fluoro-3-morpholin-4-ylsulfonylbenzoate is COc1ccccc1OC(=O)c1ccc(F)c(S(=O)(=O)N2CCOCC2)c1.
What is the InChIKey of (2-methoxyphenyl) 4-fluoro-3-morpholin-4-ylsulfonylbenzoate?
The InChIKey is CWCHRHYAXNXYGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18FNO6S/c1-24-15-4-2-3-5-16(15)26-18(21)13-6-7-14(19)17(12-13)27(22,23)20-8-10-25-11-9-20/h2-7,12H,8-11H2,1H3.
What are the key properties of (2-methoxyphenyl) 4-fluoro-3-morpholin-4-ylsulfonylbenzoate?
(2-methoxyphenyl) 4-fluoro-3-morpholin-4-ylsulfonylbenzoate has a molecular weight of 395.41 g/mol, XLogP of 2.07, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxyphenyl) 4-fluoro-3-morpholin-4-ylsulfonylbenzoate is sourced from PubChem (CID 8778499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).