C18H16FNO7S — CID 3280819
1,3-benzodioxol-5-yl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 3280819) has the molecular formula C18H16FNO7S and a molecular weight of 409.39 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | 1,3-benzodioxol-5-yl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 3280819 |
| Molecular Formula | C18H16FNO7S |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | 1,3-benzodioxol-5-yl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(Oc1ccc2c(c1)OCO2)c1ccc(F)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C18H16FNO7S/c19-14-3-1-12(9-17(14)28(22,23)20-5-7-24-8-6-20)18(21)27-13-2-4-15-16(10-13)26-11-25-15/h1-4,9-10H,5-8,11H2 |
| InChIKey | AJWNWYURODWFHX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|