C19H16FN3O6S — CID 16551651
[4-(1,3,4-oxadiazol-2-yl)phenyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 16551651) has the molecular formula C19H16FN3O6S and a molecular weight of 433.42 g/mol. Its IUPAC name is [4-(1,3,4-oxadiazol-2-yl)phenyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [4-(1,3,4-oxadiazol-2-yl)phenyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16551651 |
| Molecular Formula | C19H16FN3O6S |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | [4-(1,3,4-oxadiazol-2-yl)phenyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(Oc1ccc(-c2nnco2)cc1)c1ccc(F)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C19H16FN3O6S/c20-16-6-3-14(11-17(16)30(25,26)23-7-9-27-10-8-23)19(24)29-15-4-1-13(2-5-15)18-22-21-12-28-18/h1-6,11-12H,7-10H2 |
| InChIKey | ZGTHFFOTPSEKOP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 111.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|