C13H13FN2O5S — CID 2681686
cyanomethyl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 2681686) has the molecular formula C13H13FN2O5S and a molecular weight of 328.32 g/mol. Its IUPAC name is cyanomethyl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | cyanomethyl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2681686 |
| Molecular Formula | C13H13FN2O5S |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | cyanomethyl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | N#CCOC(=O)c1ccc(F)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C13H13FN2O5S/c14-11-2-1-10(13(17)21-6-3-15)9-12(11)22(18,19)16-4-7-20-8-5-16/h1-2,9H,4-8H2 |
| InChIKey | NFJLTNPNANTNNC-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |