C17H18FN3O6S — CID 7853305
(3-cyano-4-imino-2-oxopentyl) 4-fluoro-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 7853305) has the molecular formula C17H18FN3O6S and a molecular weight of 411.41 g/mol. Its IUPAC name is (3-cyano-4-imino-2-oxopentyl) 4-fluoro-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | (3-cyano-4-imino-2-oxopentyl) 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 7853305 |
| Molecular Formula | C17H18FN3O6S |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | (3-cyano-4-imino-2-oxopentyl) 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)COC(=O)c1ccc(F)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C17H18FN3O6S/c1-11(20)13(9-19)15(22)10-27-17(23)12-2-3-14(18)16(8-12)28(24,25)21-4-6-26-7-5-21/h2-3,8,13,20H,4-7,10H2,1H3/b20-11+ |
| InChIKey | SIEXREXLXQSFBM-RGVLZGJSSA-N |
| XLogP | 0.75 |
| TPSA | 137.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|