C17H16FNO6S2 — CID 7970340
(2-oxo-2-thiophen-2-ylethyl) 4-fluoro-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 7970340) has the molecular formula C17H16FNO6S2 and a molecular weight of 413.45 g/mol. Its IUPAC name is (2-oxo-2-thiophen-2-ylethyl) 4-fluoro-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | (2-oxo-2-thiophen-2-ylethyl) 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 7970340 |
| Molecular Formula | C17H16FNO6S2 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | (2-oxo-2-thiophen-2-ylethyl) 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(OCC(=O)c1cccs1)c1ccc(F)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C17H16FNO6S2/c18-13-4-3-12(17(21)25-11-14(20)15-2-1-9-26-15)10-16(13)27(22,23)19-5-7-24-8-6-19/h1-4,9-10H,5-8,11H2 |
| InChIKey | IWYJTKWPISHZPH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |