C18H19FN2O6S2 — CID 4302428
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 4302428) has the molecular formula C18H19FN2O6S2 and a molecular weight of 442.49 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 4302428 |
| Molecular Formula | C18H19FN2O6S2 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(F)c(S(=O)(=O)N2CCOCC2)c1)NCc1cccs1 |
| InChI | InChI=1S/C18H19FN2O6S2/c19-15-4-3-13(10-16(15)29(24,25)21-5-7-26-8-6-21)18(23)27-12-17(22)20-11-14-2-1-9-28-14/h1-4,9-10H,5-8,11-12H2,(H,20,22) |
| InChIKey | IKXISOTUYSCUGJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |