C20H18F4N2O6S — CID 16521432
[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 16521432) has the molecular formula C20H18F4N2O6S and a molecular weight of 490.43 g/mol. Its IUPAC name is [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16521432 |
| Molecular Formula | C20H18F4N2O6S |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(F)c(S(=O)(=O)N2CCOCC2)c1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H18F4N2O6S/c21-15-6-5-13(11-17(15)33(29,30)26-7-9-31-10-8-26)19(28)32-12-18(27)25-16-4-2-1-3-14(16)20(22,23)24/h1-6,11H,7-10,12H2,(H,25,27) |
| InChIKey | MCERFNQIYAQTDV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |