C17H17NO6S2 — CID 8631773
[2-(4-morpholin-4-ylsulfonylphenyl)-2-oxoethyl] thiophene-2-carboxylate (PubChem CID 8631773) has the molecular formula C17H17NO6S2 and a molecular weight of 395.46 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylsulfonylphenyl)-2-oxoethyl] thiophene-2-carboxylate.
| Compound Name | [2-(4-morpholin-4-ylsulfonylphenyl)-2-oxoethyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 8631773 |
| Molecular Formula | C17H17NO6S2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | [2-(4-morpholin-4-ylsulfonylphenyl)-2-oxoethyl] thiophene-2-carboxylate |
| SMILES | O=C(COC(=O)c1cccs1)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C17H17NO6S2/c19-15(12-24-17(20)16-2-1-11-25-16)13-3-5-14(6-4-13)26(21,22)18-7-9-23-10-8-18/h1-6,11H,7-10,12H2 |
| InChIKey | RVIXLKMLAJIJEZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |