C17H17ClN2O6S2 — CID 3893296
[2-(2-Chloro-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] thiophene-2-carboxylate (PubChem CID 3893296) has the molecular formula C17H17ClN2O6S2 and a molecular weight of 444.90 g/mol. Its IUPAC name is [2-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] thiophene-2-carboxylate.
| Compound Name | [2-(2-Chloro-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 3893296 |
| Molecular Formula | C17H17ClN2O6S2 |
| Molecular Weight | 444.90 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | [2-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] thiophene-2-carboxylate |
| SMILES | C1COCCN1S(=O)(=O)C2=CC(=C(C=C2)Cl)NC(=O)COC(=O)C3=CC=CS3 |
| InChI | InChI=1S/C17H17ClN2O6S2/c18-13-4-3-12(28(23,24)20-5-7-25-8-6-20)10-14(13)19-16(21)11-26-17(22)15-2-1-9-27-15/h1-4,9-10H,5-8,11H2,(H,19,21) |
| InChIKey | QHGHWLCMSAMQGN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | 665 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.90 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |