C26H22FNO6S — CID 2462527
[2-(9H-fluoren-3-yl)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 2462527) has the molecular formula C26H22FNO6S and a molecular weight of 495.53 g/mol. Its IUPAC name is [2-(9H-fluoren-3-yl)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-(9H-fluoren-3-yl)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2462527 |
| Molecular Formula | C26H22FNO6S |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | [2-(9H-fluoren-3-yl)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(F)c(S(=O)(=O)N2CCOCC2)c1)c1ccc2c(c1)-c1ccccc1C2 |
| InChI | InChI=1S/C26H22FNO6S/c27-23-8-7-20(15-25(23)35(31,32)28-9-11-33-12-10-28)26(30)34-16-24(29)19-6-5-18-13-17-3-1-2-4-21(17)22(18)14-19/h1-8,14-15H,9-13,16H2 |
| InChIKey | BBGNXFVJBNXAHS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |