C27H25NO6S — CID 2102172
[2-(9H-fluoren-3-yl)-2-oxoethyl] 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 2102172) has the molecular formula C27H25NO6S and a molecular weight of 491.57 g/mol. Its IUPAC name is [2-(9H-fluoren-3-yl)-2-oxoethyl] 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | [2-(9H-fluoren-3-yl)-2-oxoethyl] 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2102172 |
| Molecular Formula | C27H25NO6S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | [2-(9H-fluoren-3-yl)-2-oxoethyl] 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)c2ccc3c(c2)-c2ccccc2C3)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C27H25NO6S/c1-33-25-11-10-21(16-26(25)35(31,32)28-12-4-5-13-28)27(30)34-17-24(29)20-9-8-19-14-18-6-2-3-7-22(18)23(19)15-20/h2-3,6-11,15-16H,4-5,12-14,17H2,1H3 |
| InChIKey | MXCKIVBPLMBPNG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |