[2-(9H-fluoren-3-yl)-2-oxoethyl] 3-methoxy-4-propoxybenzoate

C26H24O5 — CID 2095942

IUPAC[2-(9H-fluoren-3-yl)-2-oxoethyl] 3-methoxy-4-propoxybenzoate
SMILESCCCOc1ccc(C(=O)OCC(=O)c2ccc3c(c2)-c2ccccc2C3)cc1OC
InChIInChI=1S/C26H24O5/c1-3-12-30-24-11-10-20(15-25(24)29-2)26(28)31-16-23(27)19-9-8-18-13-17-6-4-5-7-21(17)22(18)14-19/h4-11,14-15H,3,12-13,16H2,1-2H3
InChIKeyDIJWEFDWHCWGJY-UHFFFAOYSA-N
MW416.47 g/mol
LogP5.09
Rot. Bonds8

About [2-(9H-fluoren-3-yl)-2-oxoethyl] 3-methoxy-4-propoxybenzoate

[2-(9H-fluoren-3-yl)-2-oxoethyl] 3-methoxy-4-propoxybenzoate (PubChem CID 2095942) has the molecular formula C26H24O5 and a molecular weight of 416.47 g/mol. Its IUPAC name is [2-(9H-fluoren-3-yl)-2-oxoethyl] 3-methoxy-4-propoxybenzoate.

Molecular Properties

Compound Name[2-(9H-fluoren-3-yl)-2-oxoethyl] 3-methoxy-4-propoxybenzoate
PubChem CID2095942
Molecular FormulaC26H24O5
Molecular Weight416.47 g/mol
Exact Mass416.16
IUPAC Name[2-(9H-fluoren-3-yl)-2-oxoethyl] 3-methoxy-4-propoxybenzoate
SMILESCCCOc1ccc(C(=O)OCC(=O)c2ccc3c(c2)-c2ccccc2C3)cc1OC
InChIInChI=1S/C26H24O5/c1-3-12-30-24-11-10-20(15-25(24)29-2)26(28)31-16-23(27)19-9-8-18-13-17-6-4-5-7-21(17)22(18)14-19/h4-11,14-15H,3,12-13,16H2,1-2H3
InChIKeyDIJWEFDWHCWGJY-UHFFFAOYSA-N
XLogP5.09
TPSA61.83 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms31
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500416.47
LogP ≤ 55.09
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze [2-(9H-fluoren-3-yl)-2-oxoethyl] 3-methoxy-4-propoxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(9H-fluoren-3-yl)-2-oxoethyl] 3-methoxy-4-propoxybenzoate?
The IUPAC name of [2-(9H-fluoren-3-yl)-2-oxoethyl] 3-methoxy-4-propoxybenzoate (CID 2095942) is [2-(9H-fluoren-3-yl)-2-oxoethyl] 3-methoxy-4-propoxybenzoate.
What is the SMILES notation for [2-(9H-fluoren-3-yl)-2-oxoethyl] 3-methoxy-4-propoxybenzoate?
The canonical SMILES for [2-(9H-fluoren-3-yl)-2-oxoethyl] 3-methoxy-4-propoxybenzoate is CCCOc1ccc(C(=O)OCC(=O)c2ccc3c(c2)-c2ccccc2C3)cc1OC.
What is the InChIKey of [2-(9H-fluoren-3-yl)-2-oxoethyl] 3-methoxy-4-propoxybenzoate?
The InChIKey is DIJWEFDWHCWGJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24O5/c1-3-12-30-24-11-10-20(15-25(24)29-2)26(28)31-16-23(27)19-9-8-18-13-17-6-4-5-7-21(17)22(18)14-19/h4-11,14-15H,3,12-13,16H2,1-2H3.
What are the key properties of [2-(9H-fluoren-3-yl)-2-oxoethyl] 3-methoxy-4-propoxybenzoate?
[2-(9H-fluoren-3-yl)-2-oxoethyl] 3-methoxy-4-propoxybenzoate has a molecular weight of 416.47 g/mol, XLogP of 5.09, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(9H-fluoren-3-yl)-2-oxoethyl] 3-methoxy-4-propoxybenzoate is sourced from PubChem (CID 2095942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).