About [2-(9H-fluoren-3-yl)-2-oxoethyl] 3-bromobenzoate
[2-(9H-fluoren-3-yl)-2-oxoethyl] 3-bromobenzoate (PubChem CID 7662912) has the molecular formula C22H15BrO3
and a molecular weight of 407.26 g/mol. Its IUPAC name is [2-(9H-fluoren-3-yl)-2-oxoethyl] 3-bromobenzoate.
Molecular Properties
| Compound Name | [2-(9H-fluoren-3-yl)-2-oxoethyl] 3-bromobenzoate |
| PubChem CID | 7662912 |
| Molecular Formula | C22H15BrO3 |
| Molecular Weight | 407.26 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | [2-(9H-fluoren-3-yl)-2-oxoethyl] 3-bromobenzoate |
| SMILES | O=C(COC(=O)c1cccc(Br)c1)c1ccc2c(c1)-c1ccccc1C2 |
| InChI | InChI=1S/C22H15BrO3/c23-18-6-3-5-17(11-18)22(25)26-13-21(24)16-9-8-15-10-14-4-1-2-7-19(14)20(15)12-16/h1-9,11-12H,10,13H2 |
| InChIKey | XNYDZYVCCKXLPV-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.26 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(9H-fluoren-3-yl)-2-oxoethyl] 3-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(9H-fluoren-3-yl)-2-oxoethyl] 3-bromobenzoate?
The IUPAC name of [2-(9H-fluoren-3-yl)-2-oxoethyl] 3-bromobenzoate (CID 7662912) is [2-(9H-fluoren-3-yl)-2-oxoethyl] 3-bromobenzoate.
What is the SMILES notation for [2-(9H-fluoren-3-yl)-2-oxoethyl] 3-bromobenzoate?
The canonical SMILES for [2-(9H-fluoren-3-yl)-2-oxoethyl] 3-bromobenzoate is O=C(COC(=O)c1cccc(Br)c1)c1ccc2c(c1)-c1ccccc1C2.
What is the InChIKey of [2-(9H-fluoren-3-yl)-2-oxoethyl] 3-bromobenzoate?
The InChIKey is XNYDZYVCCKXLPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15BrO3/c23-18-6-3-5-17(11-18)22(25)26-13-21(24)16-9-8-15-10-14-4-1-2-7-19(14)20(15)12-16/h1-9,11-12H,10,13H2.
What are the key properties of [2-(9H-fluoren-3-yl)-2-oxoethyl] 3-bromobenzoate?
[2-(9H-fluoren-3-yl)-2-oxoethyl] 3-bromobenzoate has a molecular weight of 407.26 g/mol, XLogP of 5.06, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(9H-fluoren-3-yl)-2-oxoethyl] 3-bromobenzoate is sourced from PubChem (CID 7662912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).