C22H14Cl2O3 — CID 7723570
[2-(9H-fluoren-3-yl)-2-oxoethyl] 2,6-dichlorobenzoate (PubChem CID 7723570) has the molecular formula C22H14Cl2O3 and a molecular weight of 397.26 g/mol. Its IUPAC name is [2-(9H-fluoren-3-yl)-2-oxoethyl] 2,6-dichlorobenzoate.
| Compound Name | [2-(9H-fluoren-3-yl)-2-oxoethyl] 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 7723570 |
| Molecular Formula | C22H14Cl2O3 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | [2-(9H-fluoren-3-yl)-2-oxoethyl] 2,6-dichlorobenzoate |
| SMILES | O=C(COC(=O)c1c(Cl)cccc1Cl)c1ccc2c(c1)-c1ccccc1C2 |
| InChI | InChI=1S/C22H14Cl2O3/c23-18-6-3-7-19(24)21(18)22(26)27-12-20(25)15-9-8-14-10-13-4-1-2-5-16(13)17(14)11-15/h1-9,11H,10,12H2 |
| InChIKey | QARTVWKUTFBYBU-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |