C25H22O6 — CID 2445435
[2-(9H-fluoren-3-yl)-2-oxoethyl] 2,4,5-trimethoxybenzoate (PubChem CID 2445435) has the molecular formula C25H22O6 and a molecular weight of 418.45 g/mol. Its IUPAC name is [2-(9H-fluoren-3-yl)-2-oxoethyl] 2,4,5-trimethoxybenzoate.
| Compound Name | [2-(9H-fluoren-3-yl)-2-oxoethyl] 2,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 2445435 |
| Molecular Formula | C25H22O6 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | [2-(9H-fluoren-3-yl)-2-oxoethyl] 2,4,5-trimethoxybenzoate |
| SMILES | COc1cc(OC)c(C(=O)OCC(=O)c2ccc3c(c2)-c2ccccc2C3)cc1OC |
| InChI | InChI=1S/C25H22O6/c1-28-22-13-24(30-3)23(29-2)12-20(22)25(27)31-14-21(26)17-9-8-16-10-15-6-4-5-7-18(15)19(16)11-17/h4-9,11-13H,10,14H2,1-3H3 |
| InChIKey | SJXLZWOQMFVHTL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |