C18H16Cl2O6 — CID 2336407
[2-(3,4-dichlorophenyl)-2-oxoethyl] 2,4,5-trimethoxybenzoate (PubChem CID 2336407) has the molecular formula C18H16Cl2O6 and a molecular weight of 399.23 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-2-oxoethyl] 2,4,5-trimethoxybenzoate.
| Compound Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 2,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 2336407 |
| Molecular Formula | C18H16Cl2O6 |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 2,4,5-trimethoxybenzoate |
| SMILES | COc1cc(OC)c(C(=O)OCC(=O)c2ccc(Cl)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C18H16Cl2O6/c1-23-15-8-17(25-3)16(24-2)7-11(15)18(22)26-9-14(21)10-4-5-12(19)13(20)6-10/h4-8H,9H2,1-3H3 |
| InChIKey | OCBOCDDDPBAOCX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |