C15H11Cl2NO3 — CID 15702453
[2-(3,4-dichlorophenyl)-2-oxoethyl] 2-aminobenzoate (PubChem CID 15702453) has the molecular formula C15H11Cl2NO3 and a molecular weight of 324.16 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-2-oxoethyl] 2-aminobenzoate.
| Compound Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 2-aminobenzoate |
|---|---|
| PubChem CID | 15702453 |
| Molecular Formula | C15H11Cl2NO3 |
| Molecular Weight | 324.16 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 2-aminobenzoate |
| SMILES | Nc1ccccc1C(=O)OCC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H11Cl2NO3/c16-11-6-5-9(7-12(11)17)14(19)8-21-15(20)10-3-1-2-4-13(10)18/h1-7H,8,18H2 |
| InChIKey | HMDLZUPVPOQOSG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.16 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|