C24H17Cl4N3O6 — CID 11692780
bis[2-(4-amino-3,5-dichlorophenyl)-2-oxoethyl] 2-aminobenzene-1,4-dicarboxylate (PubChem CID 11692780) has the molecular formula C24H17Cl4N3O6 and a molecular weight of 585.23 g/mol. Its IUPAC name is bis[2-(4-amino-3,5-dichlorophenyl)-2-oxoethyl] 2-aminobenzene-1,4-dicarboxylate.
| Compound Name | bis[2-(4-amino-3,5-dichlorophenyl)-2-oxoethyl] 2-aminobenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 11692780 |
| Molecular Formula | C24H17Cl4N3O6 |
| Molecular Weight | 585.23 g/mol |
| Exact Mass | 582.99 |
| IUPAC Name | bis[2-(4-amino-3,5-dichlorophenyl)-2-oxoethyl] 2-aminobenzene-1,4-dicarboxylate |
| SMILES | Nc1cc(C(=O)OCC(=O)c2cc(Cl)c(N)c(Cl)c2)ccc1C(=O)OCC(=O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C24H17Cl4N3O6/c25-14-3-11(4-15(26)21(14)30)19(32)8-36-23(34)10-1-2-13(18(29)7-10)24(35)37-9-20(33)12-5-16(27)22(31)17(28)6-12/h1-7H,8-9,29-31H2 |
| InChIKey | KINXYJNQRNUGJW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 164.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.23 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|