C24H17Br2NO6 — CID 11613938
bis[2-(2-bromophenyl)-2-oxoethyl] 2-aminobenzene-1,4-dicarboxylate (PubChem CID 11613938) has the molecular formula C24H17Br2NO6 and a molecular weight of 575.21 g/mol. Its IUPAC name is bis[2-(2-bromophenyl)-2-oxoethyl] 2-aminobenzene-1,4-dicarboxylate.
| Compound Name | bis[2-(2-bromophenyl)-2-oxoethyl] 2-aminobenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 11613938 |
| Molecular Formula | C24H17Br2NO6 |
| Molecular Weight | 575.21 g/mol |
| Exact Mass | 572.94 |
| IUPAC Name | bis[2-(2-bromophenyl)-2-oxoethyl] 2-aminobenzene-1,4-dicarboxylate |
| SMILES | Nc1cc(C(=O)OCC(=O)c2ccccc2Br)ccc1C(=O)OCC(=O)c1ccccc1Br |
| InChI | InChI=1S/C24H17Br2NO6/c25-18-7-3-1-5-15(18)21(28)12-32-23(30)14-9-10-17(20(27)11-14)24(31)33-13-22(29)16-6-2-4-8-19(16)26/h1-11H,12-13,27H2 |
| InChIKey | ZTHDSSQRBNWLBF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.21 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|