About phenacyl 3-bromo-4-methylbenzoate
phenacyl 3-bromo-4-methylbenzoate (PubChem CID 882326) has the molecular formula C16H13BrO3
and a molecular weight of 333.18 g/mol. Its IUPAC name is phenacyl 3-bromo-4-methylbenzoate.
Molecular Properties
| Compound Name | phenacyl 3-bromo-4-methylbenzoate |
| PubChem CID | 882326 |
| Molecular Formula | C16H13BrO3 |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | phenacyl 3-bromo-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)c2ccccc2)cc1Br |
| InChI | InChI=1S/C16H13BrO3/c1-11-7-8-13(9-14(11)17)16(19)20-10-15(18)12-5-3-2-4-6-12/h2-9H,10H2,1H3 |
| InChIKey | TYZPSIDFVJFTII-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze phenacyl 3-bromo-4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenacyl 3-bromo-4-methylbenzoate?
The IUPAC name of phenacyl 3-bromo-4-methylbenzoate (CID 882326) is phenacyl 3-bromo-4-methylbenzoate.
What is the SMILES notation for phenacyl 3-bromo-4-methylbenzoate?
The canonical SMILES for phenacyl 3-bromo-4-methylbenzoate is Cc1ccc(C(=O)OCC(=O)c2ccccc2)cc1Br.
What is the InChIKey of phenacyl 3-bromo-4-methylbenzoate?
The InChIKey is TYZPSIDFVJFTII-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13BrO3/c1-11-7-8-13(9-14(11)17)16(19)20-10-15(18)12-5-3-2-4-6-12/h2-9H,10H2,1H3.
What are the key properties of phenacyl 3-bromo-4-methylbenzoate?
phenacyl 3-bromo-4-methylbenzoate has a molecular weight of 333.18 g/mol, XLogP of 3.80, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenacyl 3-bromo-4-methylbenzoate is sourced from PubChem (CID 882326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).