C23H18N2O3 — CID 7043609
phenacyl 2-methyl-1-phenylbenzimidazole-5-carboxylate (PubChem CID 7043609) has the molecular formula C23H18N2O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is phenacyl 2-methyl-1-phenylbenzimidazole-5-carboxylate.
| Compound Name | phenacyl 2-methyl-1-phenylbenzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 7043609 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | phenacyl 2-methyl-1-phenylbenzimidazole-5-carboxylate |
| SMILES | Cc1nc2cc(C(=O)OCC(=O)c3ccccc3)ccc2n1-c1ccccc1 |
| InChI | InChI=1S/C23H18N2O3/c1-16-24-20-14-18(12-13-21(20)25(16)19-10-6-3-7-11-19)23(27)28-15-22(26)17-8-4-2-5-9-17/h2-14H,15H2,1H3 |
| InChIKey | IQCDPUAGVVCBLE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |