C22H24N2O2 — CID 7171317
cyclohexylmethyl 2-methyl-1-phenylbenzimidazole-5-carboxylate (PubChem CID 7171317) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is cyclohexylmethyl 2-methyl-1-phenylbenzimidazole-5-carboxylate.
| Compound Name | cyclohexylmethyl 2-methyl-1-phenylbenzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 7171317 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | cyclohexylmethyl 2-methyl-1-phenylbenzimidazole-5-carboxylate |
| SMILES | Cc1nc2cc(C(=O)OCC3CCCCC3)ccc2n1-c1ccccc1 |
| InChI | InChI=1S/C22H24N2O2/c1-16-23-20-14-18(22(25)26-15-17-8-4-2-5-9-17)12-13-21(20)24(16)19-10-6-3-7-11-19/h3,6-7,10-14,17H,2,4-5,8-9,15H2,1H3 |
| InChIKey | VDZONOASNZMSNI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |