C23H24N4O4 — CID 4022244
[2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-methyl-1-phenylbenzimidazole-5-carboxylate (PubChem CID 4022244) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-methyl-1-phenylbenzimidazole-5-carboxylate.
| Compound Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-methyl-1-phenylbenzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 4022244 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-methyl-1-phenylbenzimidazole-5-carboxylate |
| SMILES | Cc1nc2cc(C(=O)OCC(=O)NC(=O)NC3CCCC3)ccc2n1-c1ccccc1 |
| InChI | InChI=1S/C23H24N4O4/c1-15-24-19-13-16(11-12-20(19)27(15)18-9-3-2-4-10-18)22(29)31-14-21(28)26-23(30)25-17-7-5-6-8-17/h2-4,9-13,17H,5-8,14H2,1H3,(H2,25,26,28,30) |
| InChIKey | QRLSQADVMSQMPC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |