C29H23N3O3 — CID 4001709
[2-oxo-2-(2-phenylanilino)ethyl] 2-methyl-1-phenylbenzimidazole-5-carboxylate (PubChem CID 4001709) has the molecular formula C29H23N3O3 and a molecular weight of 461.52 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylanilino)ethyl] 2-methyl-1-phenylbenzimidazole-5-carboxylate.
| Compound Name | [2-oxo-2-(2-phenylanilino)ethyl] 2-methyl-1-phenylbenzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 4001709 |
| Molecular Formula | C29H23N3O3 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | [2-oxo-2-(2-phenylanilino)ethyl] 2-methyl-1-phenylbenzimidazole-5-carboxylate |
| SMILES | Cc1nc2cc(C(=O)OCC(=O)Nc3ccccc3-c3ccccc3)ccc2n1-c1ccccc1 |
| InChI | InChI=1S/C29H23N3O3/c1-20-30-26-18-22(16-17-27(26)32(20)23-12-6-3-7-13-23)29(34)35-19-28(33)31-25-15-9-8-14-24(25)21-10-4-2-5-11-21/h2-18H,19H2,1H3,(H,31,33) |
| InChIKey | JBJWYVQEOHFJKD-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |