C21H20N4O4 — CID 7043534
[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-methyl-1-phenylbenzimidazole-5-carboxylate (PubChem CID 7043534) has the molecular formula C21H20N4O4 and a molecular weight of 392.42 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-methyl-1-phenylbenzimidazole-5-carboxylate.
| Compound Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-methyl-1-phenylbenzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 7043534 |
| Molecular Formula | C21H20N4O4 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-methyl-1-phenylbenzimidazole-5-carboxylate |
| SMILES | C=CCNC(=O)NC(=O)COC(=O)c1ccc2c(c1)nc(C)n2-c1ccccc1 |
| InChI | InChI=1S/C21H20N4O4/c1-3-11-22-21(28)24-19(26)13-29-20(27)15-9-10-18-17(12-15)23-14(2)25(18)16-7-5-4-6-8-16/h3-10,12H,1,11,13H2,2H3,(H2,22,24,26,28) |
| InChIKey | ASLXWTOUJQWBBH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|