C21H20N2O3 — CID 7171323
[(1S)-2-oxocyclohexyl] 2-methyl-1-phenylbenzimidazole-5-carboxylate (PubChem CID 7171323) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is [(1S)-2-oxocyclohexyl] 2-methyl-1-phenylbenzimidazole-5-carboxylate.
| Compound Name | [(1S)-2-oxocyclohexyl] 2-methyl-1-phenylbenzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 7171323 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | [(1S)-2-oxocyclohexyl] 2-methyl-1-phenylbenzimidazole-5-carboxylate |
| SMILES | Cc1nc2cc(C(=O)O[C@H]3CCCCC3=O)ccc2n1-c1ccccc1 |
| InChI | InChI=1S/C21H20N2O3/c1-14-22-17-13-15(21(25)26-20-10-6-5-9-19(20)24)11-12-18(17)23(14)16-7-3-2-4-8-16/h2-4,7-8,11-13,20H,5-6,9-10H2,1H3/t20-/m0/s1 |
| InChIKey | RPPXOCLXFCYJHR-FQEVSTJZSA-N |
| XLogP | 4.00 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |