C22H23N3O3 — CID 122113357
6-methyl-1-(2-methyl-1-phenylbenzimidazole-5-carbonyl)piperidine-3-carboxylic acid (PubChem CID 122113357) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 6-methyl-1-(2-methyl-1-phenylbenzimidazole-5-carbonyl)piperidine-3-carboxylic acid.
| Compound Name | 6-methyl-1-(2-methyl-1-phenylbenzimidazole-5-carbonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122113357 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 6-methyl-1-(2-methyl-1-phenylbenzimidazole-5-carbonyl)piperidine-3-carboxylic acid |
| SMILES | Cc1nc2cc(C(=O)N3CC(C(=O)O)CCC3C)ccc2n1-c1ccccc1 |
| InChI | InChI=1S/C22H23N3O3/c1-14-8-9-17(22(27)28)13-24(14)21(26)16-10-11-20-19(12-16)23-15(2)25(20)18-6-4-3-5-7-18/h3-7,10-12,14,17H,8-9,13H2,1-2H3,(H,27,28) |
| InChIKey | IZJWZJONKWSSCL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |