C17H15BrO3 — CID 2345743
[2-(2-bromophenyl)-2-oxoethyl] 2,5-dimethylbenzoate (PubChem CID 2345743) has the molecular formula C17H15BrO3 and a molecular weight of 347.21 g/mol. Its IUPAC name is [2-(2-bromophenyl)-2-oxoethyl] 2,5-dimethylbenzoate.
| Compound Name | [2-(2-bromophenyl)-2-oxoethyl] 2,5-dimethylbenzoate |
|---|---|
| PubChem CID | 2345743 |
| Molecular Formula | C17H15BrO3 |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | [2-(2-bromophenyl)-2-oxoethyl] 2,5-dimethylbenzoate |
| SMILES | Cc1ccc(C)c(C(=O)OCC(=O)c2ccccc2Br)c1 |
| InChI | InChI=1S/C17H15BrO3/c1-11-7-8-12(2)14(9-11)17(20)21-10-16(19)13-5-3-4-6-15(13)18/h3-9H,10H2,1-2H3 |
| InChIKey | FQRYRIBQKGGIMX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |