C19H19NO5 — CID 46641142
[2-(2,5-dimethylphenyl)-2-oxoethyl] 2-(2-amino-2-oxoethoxy)benzoate (PubChem CID 46641142) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-(2-amino-2-oxoethoxy)benzoate.
| Compound Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-(2-amino-2-oxoethoxy)benzoate |
|---|---|
| PubChem CID | 46641142 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-(2-amino-2-oxoethoxy)benzoate |
| SMILES | Cc1ccc(C)c(C(=O)COC(=O)c2ccccc2OCC(N)=O)c1 |
| InChI | InChI=1S/C19H19NO5/c1-12-7-8-13(2)15(9-12)16(21)10-25-19(23)14-5-3-4-6-17(14)24-11-18(20)22/h3-9H,10-11H2,1-2H3,(H2,20,22) |
| InChIKey | DHKICSZDRPWDLT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |