C19H17NO4 — CID 9274969
[2-(2,5-dimethylphenyl)-2-oxoethyl] 2-(2-cyanophenoxy)acetate (PubChem CID 9274969) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-(2-cyanophenoxy)acetate.
| Compound Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-(2-cyanophenoxy)acetate |
|---|---|
| PubChem CID | 9274969 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-(2-cyanophenoxy)acetate |
| SMILES | Cc1ccc(C)c(C(=O)COC(=O)COc2ccccc2C#N)c1 |
| InChI | InChI=1S/C19H17NO4/c1-13-7-8-14(2)16(9-13)17(21)11-24-19(22)12-23-18-6-4-3-5-15(18)10-20/h3-9H,11-12H2,1-2H3 |
| InChIKey | IQEMQIQBVKKNEU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |