C18H17NO3 — CID 8915413
(2,4,6-trimethylphenyl) 2-(2-cyanophenoxy)acetate (PubChem CID 8915413) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl) 2-(2-cyanophenoxy)acetate.
| Compound Name | (2,4,6-trimethylphenyl) 2-(2-cyanophenoxy)acetate |
|---|---|
| PubChem CID | 8915413 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | (2,4,6-trimethylphenyl) 2-(2-cyanophenoxy)acetate |
| SMILES | Cc1cc(C)c(OC(=O)COc2ccccc2C#N)c(C)c1 |
| InChI | InChI=1S/C18H17NO3/c1-12-8-13(2)18(14(3)9-12)22-17(20)11-21-16-7-5-4-6-15(16)10-19/h4-9H,11H2,1-3H3 |
| InChIKey | IABUMMBFDKFEAC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|