C18H20O3 — CID 19179491
(2-methylphenyl) 2-(2,3,5-trimethylphenoxy)acetate (PubChem CID 19179491) has the molecular formula C18H20O3 and a molecular weight of 284.35 g/mol. Its IUPAC name is (2-methylphenyl) 2-(2,3,5-trimethylphenoxy)acetate.
| Compound Name | (2-methylphenyl) 2-(2,3,5-trimethylphenoxy)acetate |
|---|---|
| PubChem CID | 19179491 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (2-methylphenyl) 2-(2,3,5-trimethylphenoxy)acetate |
| SMILES | Cc1cc(C)c(C)c(OCC(=O)Oc2ccccc2C)c1 |
| InChI | InChI=1S/C18H20O3/c1-12-9-14(3)15(4)17(10-12)20-11-18(19)21-16-8-6-5-7-13(16)2/h5-10H,11H2,1-4H3 |
| InChIKey | BTJQFLKKRLGAHV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|