[2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-cyanophenoxy)acetate

C19H17NO6 — CID 9318517

IUPAC[2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-cyanophenoxy)acetate
SMILESCOc1ccc(OC)c(C(=O)COC(=O)COc2ccccc2C#N)c1
InChIInChI=1S/C19H17NO6/c1-23-14-7-8-18(24-2)15(9-14)16(21)11-26-19(22)12-25-17-6-4-3-5-13(17)10-20/h3-9H,11-12H2,1-2H3
InChIKeyDAGGYFKAZIHZLK-UHFFFAOYSA-N
MW355.35 g/mol
LogP2.38
Rot. Bonds8

About [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-cyanophenoxy)acetate

[2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-cyanophenoxy)acetate (PubChem CID 9318517) has the molecular formula C19H17NO6 and a molecular weight of 355.35 g/mol. Its IUPAC name is [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-cyanophenoxy)acetate.

Molecular Properties

Compound Name[2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-cyanophenoxy)acetate
PubChem CID9318517
Molecular FormulaC19H17NO6
Molecular Weight355.35 g/mol
Exact Mass355.11
IUPAC Name[2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-cyanophenoxy)acetate
SMILESCOc1ccc(OC)c(C(=O)COC(=O)COc2ccccc2C#N)c1
InChIInChI=1S/C19H17NO6/c1-23-14-7-8-18(24-2)15(9-14)16(21)11-26-19(22)12-25-17-6-4-3-5-13(17)10-20/h3-9H,11-12H2,1-2H3
InChIKeyDAGGYFKAZIHZLK-UHFFFAOYSA-N
XLogP2.38
TPSA94.85 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds8
Heavy Atoms26
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500355.35
LogP ≤ 52.38
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Analyze [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-cyanophenoxy)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-cyanophenoxy)acetate?
The IUPAC name of [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-cyanophenoxy)acetate (CID 9318517) is [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-cyanophenoxy)acetate.
What is the SMILES notation for [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-cyanophenoxy)acetate?
The canonical SMILES for [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-cyanophenoxy)acetate is COc1ccc(OC)c(C(=O)COC(=O)COc2ccccc2C#N)c1.
What is the InChIKey of [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-cyanophenoxy)acetate?
The InChIKey is DAGGYFKAZIHZLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO6/c1-23-14-7-8-18(24-2)15(9-14)16(21)11-26-19(22)12-25-17-6-4-3-5-13(17)10-20/h3-9H,11-12H2,1-2H3.
What are the key properties of [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-cyanophenoxy)acetate?
[2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-cyanophenoxy)acetate has a molecular weight of 355.35 g/mol, XLogP of 2.38, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-cyanophenoxy)acetate is sourced from PubChem (CID 9318517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).