C13H16ClNO3 — CID 7764951
(3,3-dimethyl-2-oxobutyl) 3-amino-4-chlorobenzoate (PubChem CID 7764951) has the molecular formula C13H16ClNO3 and a molecular weight of 269.73 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 3-amino-4-chlorobenzoate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 7764951 |
| Molecular Formula | C13H16ClNO3 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 3-amino-4-chlorobenzoate |
| SMILES | CC(C)(C)C(=O)COC(=O)c1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C13H16ClNO3/c1-13(2,3)11(16)7-18-12(17)8-4-5-9(14)10(15)6-8/h4-6H,7,15H2,1-3H3 |
| InChIKey | PBTKYUXSAXKBAP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|