C13H15ClN2O3 — CID 47485540
[2-[cyclopropyl(methyl)amino]-2-oxoethyl] 3-amino-4-chlorobenzoate (PubChem CID 47485540) has the molecular formula C13H15ClN2O3 and a molecular weight of 282.73 g/mol. Its IUPAC name is [2-[cyclopropyl(methyl)amino]-2-oxoethyl] 3-amino-4-chlorobenzoate.
| Compound Name | [2-[cyclopropyl(methyl)amino]-2-oxoethyl] 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 47485540 |
| Molecular Formula | C13H15ClN2O3 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | [2-[cyclopropyl(methyl)amino]-2-oxoethyl] 3-amino-4-chlorobenzoate |
| SMILES | CN(C(=O)COC(=O)c1ccc(Cl)c(N)c1)C1CC1 |
| InChI | InChI=1S/C13H15ClN2O3/c1-16(9-3-4-9)12(17)7-19-13(18)8-2-5-10(14)11(15)6-8/h2,5-6,9H,3-4,7,15H2,1H3 |
| InChIKey | AAMBSAMHVZSOJF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|