C17H23ClN2O3 — CID 7614757
[(2R)-1-[cyclohexyl(methyl)amino]-1-oxopropan-2-yl] 3-amino-4-chlorobenzoate (PubChem CID 7614757) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.84 g/mol. Its IUPAC name is [(2R)-1-[cyclohexyl(methyl)amino]-1-oxopropan-2-yl] 3-amino-4-chlorobenzoate.
| Compound Name | [(2R)-1-[cyclohexyl(methyl)amino]-1-oxopropan-2-yl] 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 7614757 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | [(2R)-1-[cyclohexyl(methyl)amino]-1-oxopropan-2-yl] 3-amino-4-chlorobenzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(Cl)c(N)c1)C(=O)N(C)C1CCCCC1 |
| InChI | InChI=1S/C17H23ClN2O3/c1-11(16(21)20(2)13-6-4-3-5-7-13)23-17(22)12-8-9-14(18)15(19)10-12/h8-11,13H,3-7,19H2,1-2H3/t11-/m1/s1 |
| InChIKey | MHQMZCFRBZZKDJ-LLVKDONJSA-N |
| XLogP | 3.26 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|