C17H20ClN3O3 — CID 7968119
[(2S)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 3-amino-4-chlorobenzoate (PubChem CID 7968119) has the molecular formula C17H20ClN3O3 and a molecular weight of 349.82 g/mol. Its IUPAC name is [(2S)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 3-amino-4-chlorobenzoate.
| Compound Name | [(2S)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 7968119 |
| Molecular Formula | C17H20ClN3O3 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | [(2S)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 3-amino-4-chlorobenzoate |
| SMILES | C[C@H](OC(=O)c1ccc(Cl)c(N)c1)C(=O)NC1(C#N)CCCCC1 |
| InChI | InChI=1S/C17H20ClN3O3/c1-11(15(22)21-17(10-19)7-3-2-4-8-17)24-16(23)12-5-6-13(18)14(20)9-12/h5-6,9,11H,2-4,7-8,20H2,1H3,(H,21,22)/t11-/m0/s1 |
| InChIKey | FTHKXLCUEHEPMD-NSHDSACASA-N |
| XLogP | 2.81 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|