C24H24N2O4 — CID 7203914
[(2R)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 4-benzoylbenzoate (PubChem CID 7203914) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is [(2R)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 4-benzoylbenzoate.
| Compound Name | [(2R)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 4-benzoylbenzoate |
|---|---|
| PubChem CID | 7203914 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | [(2R)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 4-benzoylbenzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(C(=O)c2ccccc2)cc1)C(=O)NC1(C#N)CCCCC1 |
| InChI | InChI=1S/C24H24N2O4/c1-17(22(28)26-24(16-25)14-6-3-7-15-24)30-23(29)20-12-10-19(11-13-20)21(27)18-8-4-2-5-9-18/h2,4-5,8-13,17H,3,6-7,14-15H2,1H3,(H,26,28)/t17-/m1/s1 |
| InChIKey | GFYKXDUCDXLNAV-QGZVFWFLSA-N |
| XLogP | 3.81 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |